C22H24ClNO — CID 156579514
(3S)-N-[2-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-3-(4-methylphenyl)propan-1-amine (PubChem CID 156579514) has the molecular formula C22H24ClNO and a molecular weight of 353.89 g/mol. Its IUPAC name is (3S)-N-[2-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-3-(4-methylphenyl)propan-1-amine.
| Compound Name | (3S)-N-[2-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-3-(4-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 156579514 |
| Molecular Formula | C22H24ClNO |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (3S)-N-[2-(4-chlorophenyl)ethyl]-3-(furan-2-yl)-3-(4-methylphenyl)propan-1-amine |
| SMILES | Cc1ccc([C@H](CCNCCc2ccc(Cl)cc2)c2ccco2)cc1 |
| InChI | InChI=1S/C22H24ClNO/c1-17-4-8-19(9-5-17)21(22-3-2-16-25-22)13-15-24-14-12-18-6-10-20(23)11-7-18/h2-11,16,21,24H,12-15H2,1H3/t21-/m0/s1 |
| InChIKey | LXLXMNGWUSDMOS-NRFANRHFSA-N |
| XLogP | 5.60 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|