C20H23NOS — CID 3366871
3-(furan-2-yl)-3-(4-methylphenyl)-N-(1-thiophen-2-ylethyl)propan-1-amine (PubChem CID 3366871) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-(4-methylphenyl)-N-(1-thiophen-2-ylethyl)propan-1-amine.
| Compound Name | 3-(furan-2-yl)-3-(4-methylphenyl)-N-(1-thiophen-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 3366871 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-(furan-2-yl)-3-(4-methylphenyl)-N-(1-thiophen-2-ylethyl)propan-1-amine |
| SMILES | Cc1ccc(C(CCNC(C)c2cccs2)c2ccco2)cc1 |
| InChI | InChI=1S/C20H23NOS/c1-15-7-9-17(10-8-15)18(19-5-3-13-22-19)11-12-21-16(2)20-6-4-14-23-20/h3-10,13-14,16,18,21H,11-12H2,1-2H3 |
| InChIKey | JFDCWISCXVUYIG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |