C18H16O2S — CID 23824722
1-(furan-2-yl)-3-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one (PubChem CID 23824722) has the molecular formula C18H16O2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-(furan-2-yl)-3-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 23824722 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(furan-2-yl)-3-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one |
| SMILES | Cc1ccc(C(CC(=O)c2ccco2)c2cccs2)cc1 |
| InChI | InChI=1S/C18H16O2S/c1-13-6-8-14(9-7-13)15(18-5-3-11-21-18)12-16(19)17-4-2-10-20-17/h2-11,15H,12H2,1H3 |
| InChIKey | PBEKRFHBLVBFSD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |