C20H17ClO4S — CID 3133583
3-(4-chlorophenyl)-1-(furan-2-yl)-3-(4-methylphenyl)sulfonylpropan-1-one (PubChem CID 3133583) has the molecular formula C20H17ClO4S and a molecular weight of 388.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(furan-2-yl)-3-(4-methylphenyl)sulfonylpropan-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(furan-2-yl)-3-(4-methylphenyl)sulfonylpropan-1-one |
|---|---|
| PubChem CID | 3133583 |
| Molecular Formula | C20H17ClO4S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(furan-2-yl)-3-(4-methylphenyl)sulfonylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(CC(=O)c2ccco2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H17ClO4S/c1-14-4-10-17(11-5-14)26(23,24)20(15-6-8-16(21)9-7-15)13-18(22)19-3-2-12-25-19/h2-12,20H,13H2,1H3 |
| InChIKey | CMXKMUMTCJYZMU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |