C16H16O4S — CID 71680534
2-[3-(furan-2-yl)-1-(4-methylphenyl)-3-oxopropyl]sulfanylacetic acid (PubChem CID 71680534) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-1-(4-methylphenyl)-3-oxopropyl]sulfanylacetic acid.
| Compound Name | 2-[3-(furan-2-yl)-1-(4-methylphenyl)-3-oxopropyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 71680534 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[3-(furan-2-yl)-1-(4-methylphenyl)-3-oxopropyl]sulfanylacetic acid |
| SMILES | Cc1ccc(C(CC(=O)c2ccco2)SCC(=O)O)cc1 |
| InChI | InChI=1S/C16H16O4S/c1-11-4-6-12(7-5-11)15(21-10-16(18)19)9-13(17)14-3-2-8-20-14/h2-8,15H,9-10H2,1H3,(H,18,19) |
| InChIKey | WOWHXRGTVDNGLZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |