C15H15FO3S — CID 2147379
(3S)-3-(4-fluorophenyl)-1-(furan-2-yl)-3-(2-hydroxyethylsulfanyl)propan-1-one (PubChem CID 2147379) has the molecular formula C15H15FO3S and a molecular weight of 294.35 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-1-(furan-2-yl)-3-(2-hydroxyethylsulfanyl)propan-1-one.
| Compound Name | (3S)-3-(4-fluorophenyl)-1-(furan-2-yl)-3-(2-hydroxyethylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 2147379 |
| Molecular Formula | C15H15FO3S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-1-(furan-2-yl)-3-(2-hydroxyethylsulfanyl)propan-1-one |
| SMILES | O=C(C[C@H](SCCO)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C15H15FO3S/c16-12-5-3-11(4-6-12)15(20-9-7-17)10-13(18)14-2-1-8-19-14/h1-6,8,15,17H,7,9-10H2/t15-/m0/s1 |
| InChIKey | RPRSHSPHMNNJAC-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |