C20H14ClF3O2S — CID 3423254
3-(4-chlorophenyl)sulfanyl-1-(furan-2-yl)-3-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 3423254) has the molecular formula C20H14ClF3O2S and a molecular weight of 410.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-1-(furan-2-yl)-3-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-1-(furan-2-yl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 3423254 |
| Molecular Formula | C20H14ClF3O2S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-1-(furan-2-yl)-3-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | O=C(CC(Sc1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1)c1ccco1 |
| InChI | InChI=1S/C20H14ClF3O2S/c21-15-7-9-16(10-8-15)27-19(12-17(25)18-2-1-11-26-18)13-3-5-14(6-4-13)20(22,23)24/h1-11,19H,12H2 |
| InChIKey | UOILWVIASYOOBH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |