C20H24NOS+ — CID 7411959
[(3S)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]-[(1S)-1-thiophen-2-ylethyl]azanium (PubChem CID 7411959) has the molecular formula C20H24NOS+ and a molecular weight of 326.49 g/mol. Its IUPAC name is [(3S)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]-[(1S)-1-thiophen-2-ylethyl]azanium.
| Compound Name | [(3S)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]-[(1S)-1-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 7411959 |
| Molecular Formula | C20H24NOS+ |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(3S)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]-[(1S)-1-thiophen-2-ylethyl]azanium |
| SMILES | Cc1ccc([C@H](CC[NH2+][C@@H](C)c2cccs2)c2ccco2)cc1 |
| InChI | InChI=1S/C20H23NOS/c1-15-7-9-17(10-8-15)18(19-5-3-13-22-19)11-12-21-16(2)20-6-4-14-23-20/h3-10,13-14,16,18,21H,11-12H2,1-2H3/p+1/t16-,18-/m0/s1 |
| InChIKey | JFDCWISCXVUYIG-WMZOPIPTSA-O |
| XLogP | 4.50 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |