C22H25ClNO+ — CID 7392780
[(1R)-1-(4-chlorophenyl)ethyl]-[(3R)-3-(furan-2-yl)-4-phenylbutyl]azanium (PubChem CID 7392780) has the molecular formula C22H25ClNO+ and a molecular weight of 354.90 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)ethyl]-[(3R)-3-(furan-2-yl)-4-phenylbutyl]azanium.
| Compound Name | [(1R)-1-(4-chlorophenyl)ethyl]-[(3R)-3-(furan-2-yl)-4-phenylbutyl]azanium |
|---|---|
| PubChem CID | 7392780 |
| Molecular Formula | C22H25ClNO+ |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)ethyl]-[(3R)-3-(furan-2-yl)-4-phenylbutyl]azanium |
| SMILES | C[C@@H]([NH2+]CC[C@@H](Cc1ccccc1)c1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClNO/c1-17(19-9-11-21(23)12-10-19)24-14-13-20(22-8-5-15-25-22)16-18-6-3-2-4-7-18/h2-12,15,17,20,24H,13-14,16H2,1H3/p+1/t17-,20+/m1/s1 |
| InChIKey | WMXGLVQQFHUUQE-XLIONFOSSA-O |
| XLogP | 4.97 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |