C22H19NO3 — CID 907476
2-[(3R)-3-(furan-2-yl)-4-phenylbutyl]isoindole-1,3-dione (PubChem CID 907476) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[(3R)-3-(furan-2-yl)-4-phenylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[(3R)-3-(furan-2-yl)-4-phenylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 907476 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[(3R)-3-(furan-2-yl)-4-phenylbutyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[C@@H](Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H19NO3/c24-21-18-9-4-5-10-19(18)22(25)23(21)13-12-17(20-11-6-14-26-20)15-16-7-2-1-3-8-16/h1-11,14,17H,12-13,15H2/t17-/m0/s1 |
| InChIKey | WCPYZSCQVJNBCM-KRWDZBQOSA-N |
| XLogP | 4.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|