C21H23ClNO+ — CID 7376292
[(1R)-1-(4-chlorophenyl)ethyl]-[(3S)-3-(furan-2-yl)-3-phenylpropyl]azanium (PubChem CID 7376292) has the molecular formula C21H23ClNO+ and a molecular weight of 340.87 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)ethyl]-[(3S)-3-(furan-2-yl)-3-phenylpropyl]azanium.
| Compound Name | [(1R)-1-(4-chlorophenyl)ethyl]-[(3S)-3-(furan-2-yl)-3-phenylpropyl]azanium |
|---|---|
| PubChem CID | 7376292 |
| Molecular Formula | C21H23ClNO+ |
| Molecular Weight | 340.87 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)ethyl]-[(3S)-3-(furan-2-yl)-3-phenylpropyl]azanium |
| SMILES | C[C@@H]([NH2+]CC[C@@H](c1ccccc1)c1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO/c1-16(17-9-11-19(22)12-10-17)23-14-13-20(21-8-5-15-24-21)18-6-3-2-4-7-18/h2-12,15-16,20,23H,13-14H2,1H3/p+1/t16-,20+/m1/s1 |
| InChIKey | OQCCEORISKRECA-UZLBHIALSA-O |
| XLogP | 4.78 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |