C19H18O2S2 — CID 703237
(3S)-3-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one (PubChem CID 703237) has the molecular formula C19H18O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (3S)-3-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | (3S)-3-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 703237 |
| Molecular Formula | C19H18O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (3S)-3-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)-3-thiophen-2-ylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C[C@H](SCc2ccco2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H18O2S2/c1-14-6-8-15(9-7-14)17(20)12-19(18-5-3-11-22-18)23-13-16-4-2-10-21-16/h2-11,19H,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | AYBIGZADJWYZJH-IBGZPJMESA-N |
| XLogP | 5.90 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |