C14H15NO4S — CID 94708709
(3R)-5-(furan-2-ylmethylamino)-5-oxo-3-thiophen-2-ylpentanoic acid (PubChem CID 94708709) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is (3R)-5-(furan-2-ylmethylamino)-5-oxo-3-thiophen-2-ylpentanoic acid.
| Compound Name | (3R)-5-(furan-2-ylmethylamino)-5-oxo-3-thiophen-2-ylpentanoic acid |
|---|---|
| PubChem CID | 94708709 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (3R)-5-(furan-2-ylmethylamino)-5-oxo-3-thiophen-2-ylpentanoic acid |
| SMILES | O=C(O)C[C@@H](CC(=O)NCc1ccco1)c1cccs1 |
| InChI | InChI=1S/C14H15NO4S/c16-13(15-9-11-3-1-5-19-11)7-10(8-14(17)18)12-4-2-6-20-12/h1-6,10H,7-9H2,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | MIVAPOKONACKHJ-SNVBAGLBSA-N |
| XLogP | 2.61 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |