C11H12N2O2S — CID 115285808
2-amino-N-(furan-2-ylmethyl)-2-thiophen-2-ylacetamide (PubChem CID 115285808) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-amino-N-(furan-2-ylmethyl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N-(furan-2-ylmethyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115285808 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-amino-N-(furan-2-ylmethyl)-2-thiophen-2-ylacetamide |
| SMILES | NC(C(=O)NCc1ccco1)c1cccs1 |
| InChI | InChI=1S/C11H12N2O2S/c12-10(9-4-2-6-16-9)11(14)13-7-8-3-1-5-15-8/h1-6,10H,7,12H2,(H,13,14) |
| InChIKey | LOUWDNGEKUDMTB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |