C17H16F3NO4 — CID 2826232
5-(furan-2-ylmethylamino)-5-oxo-3-[4-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 2826232) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)-5-oxo-3-[4-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 5-(furan-2-ylmethylamino)-5-oxo-3-[4-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 2826232 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 5-(furan-2-ylmethylamino)-5-oxo-3-[4-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | O=C(O)CC(CC(=O)NCc1ccco1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO4/c18-17(19,20)13-5-3-11(4-6-13)12(9-16(23)24)8-15(22)21-10-14-2-1-7-25-14/h1-7,12H,8-10H2,(H,21,22)(H,23,24) |
| InChIKey | ABHSOIKWKFEVLM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |