C14H11F3N2O — CID 84816650
2-(furan-2-ylmethylamino)-2-[4-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 84816650) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-2-[4-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-(furan-2-ylmethylamino)-2-[4-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 84816650 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-2-[4-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CC(NCc1ccco1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3N2O/c15-14(16,17)11-5-3-10(4-6-11)13(8-18)19-9-12-2-1-7-20-12/h1-7,13,19H,9H2 |
| InChIKey | YLGBSCXYWRHXNQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |