C17H20N2S — CID 61005238
2-(4-tert-butylphenyl)-2-(thiophen-2-ylmethylamino)acetonitrile (PubChem CID 61005238) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-(thiophen-2-ylmethylamino)acetonitrile.
| Compound Name | 2-(4-tert-butylphenyl)-2-(thiophen-2-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 61005238 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-(thiophen-2-ylmethylamino)acetonitrile |
| SMILES | CC(C)(C)c1ccc(C(C#N)NCc2cccs2)cc1 |
| InChI | InChI=1S/C17H20N2S/c1-17(2,3)14-8-6-13(7-9-14)16(11-18)19-12-15-5-4-10-20-15/h4-10,16,19H,12H2,1-3H3 |
| InChIKey | WEIMVLGRQQMOGX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |