C16H14N4S — CID 61005442
2-(1-phenylpyrazol-4-yl)-2-(thiophen-2-ylmethylamino)acetonitrile (PubChem CID 61005442) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(1-phenylpyrazol-4-yl)-2-(thiophen-2-ylmethylamino)acetonitrile.
| Compound Name | 2-(1-phenylpyrazol-4-yl)-2-(thiophen-2-ylmethylamino)acetonitrile |
|---|---|
| PubChem CID | 61005442 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(1-phenylpyrazol-4-yl)-2-(thiophen-2-ylmethylamino)acetonitrile |
| SMILES | N#CC(NCc1cccs1)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H14N4S/c17-9-16(18-11-15-7-4-8-21-15)13-10-19-20(12-13)14-5-2-1-3-6-14/h1-8,10,12,16,18H,11H2 |
| InChIKey | INKHMMYSGLJFBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |