C16H13N5O — CID 95237324
N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 95237324) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 95237324 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | N#C[C@H](NC(=O)c1ccc[nH]1)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H13N5O/c17-9-15(20-16(22)14-7-4-8-18-14)12-10-19-21(11-12)13-5-2-1-3-6-13/h1-8,10-11,15,18H,(H,20,22)/t15-/m0/s1 |
| InChIKey | KHBHBKCVYZIWQZ-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |