C15H13N5O3 — CID 124736796
cis-(1S,2R)-N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 124736796) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124736796 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | cis-(1S,2R)-N-[(R)-cyano-(1-phenylpyrazol-4-yl)methyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | N#C[C@H](NC(=O)[C@H]1C[C@H]1[N+](=O)[O-])c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H13N5O3/c16-7-13(18-15(21)12-6-14(12)20(22)23)10-8-17-19(9-10)11-4-2-1-3-5-11/h1-5,8-9,12-14H,6H2,(H,18,21)/t12-,13-,14+/m0/s1 |
| InChIKey | PDHYHHAPJVFKMF-MELADBBJSA-N |
| XLogP | 1.22 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|