C16H16FNO3S — CID 100816122
(3R)-5-[(4-fluorophenyl)methylamino]-5-oxo-3-thiophen-2-ylpentanoic acid (PubChem CID 100816122) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is (3R)-5-[(4-fluorophenyl)methylamino]-5-oxo-3-thiophen-2-ylpentanoic acid.
| Compound Name | (3R)-5-[(4-fluorophenyl)methylamino]-5-oxo-3-thiophen-2-ylpentanoic acid |
|---|---|
| PubChem CID | 100816122 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (3R)-5-[(4-fluorophenyl)methylamino]-5-oxo-3-thiophen-2-ylpentanoic acid |
| SMILES | O=C(O)C[C@@H](CC(=O)NCc1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C16H16FNO3S/c17-13-5-3-11(4-6-13)10-18-15(19)8-12(9-16(20)21)14-2-1-7-22-14/h1-7,12H,8-10H2,(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | CGLNNIDLYDKOCJ-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |