C17H17F3N2O2S — CID 41435480
(3R)-3-acetamido-3-thiophen-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 41435480) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is (3R)-3-acetamido-3-thiophen-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | (3R)-3-acetamido-3-thiophen-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 41435480 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (3R)-3-acetamido-3-thiophen-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(=O)N[C@H](CC(=O)NCc1ccc(C(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C17H17F3N2O2S/c1-11(23)22-14(15-3-2-8-25-15)9-16(24)21-10-12-4-6-13(7-5-12)17(18,19)20/h2-8,14H,9-10H2,1H3,(H,21,24)(H,22,23)/t14-/m1/s1 |
| InChIKey | RCRZQYFNJVDCKI-CQSZACIVSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |