C22H22N4O3S — CID 55903975
N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 55903975) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55903975 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | CC(=O)NC(CC(=O)NCc1cccc(NC(=O)c2ccncc2)c1)c1cccs1 |
| InChI | InChI=1S/C22H22N4O3S/c1-15(27)25-19(20-6-3-11-30-20)13-21(28)24-14-16-4-2-5-18(12-16)26-22(29)17-7-9-23-10-8-17/h2-12,19H,13-14H2,1H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | RPRSHEQKEVROJG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |