C24H25N3O3S — CID 55898896
N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]-4-methylbenzamide (PubChem CID 55898896) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55898896 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[3-[[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]methyl]phenyl]-4-methylbenzamide |
| SMILES | CC(=O)NC(CC(=O)NCc1cccc(NC(=O)c2ccc(C)cc2)c1)c1cccs1 |
| InChI | InChI=1S/C24H25N3O3S/c1-16-8-10-19(11-9-16)24(30)27-20-6-3-5-18(13-20)15-25-23(29)14-21(26-17(2)28)22-7-4-12-31-22/h3-13,21H,14-15H2,1-2H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | MZYJYLAJMVVYOM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |