C13H17N3OS — CID 102630594
[5-(4-phenylbutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 102630594) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is [5-(4-phenylbutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine.
| Compound Name | [5-(4-phenylbutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 102630594 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [5-(4-phenylbutylsulfanyl)-1,3,4-oxadiazol-2-yl]methanamine |
| SMILES | NCc1nnc(SCCCCc2ccccc2)o1 |
| InChI | InChI=1S/C13H17N3OS/c14-10-12-15-16-13(17-12)18-9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10,14H2 |
| InChIKey | DUDWSRJISBEPQN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|