C12H14N2O3S2 — CID 47096888
2-benzyl-5-(2-methylsulfonylethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 47096888) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-benzyl-5-(2-methylsulfonylethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-benzyl-5-(2-methylsulfonylethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 47096888 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-benzyl-5-(2-methylsulfonylethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)CCSc1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-19(15,16)8-7-18-12-14-13-11(17-12)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | ZKWVRBOMBUCTHQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |