C11H12N2O3S — CID 121219782
2-benzyl-5-ethylsulfonyl-1,3,4-oxadiazole (PubChem CID 121219782) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-benzyl-5-ethylsulfonyl-1,3,4-oxadiazole.
| Compound Name | 2-benzyl-5-ethylsulfonyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 121219782 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-benzyl-5-ethylsulfonyl-1,3,4-oxadiazole |
| SMILES | CCS(=O)(=O)c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C11H12N2O3S/c1-2-17(14,15)11-13-12-10(16-11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | WMGRTGRSKFUGHS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |