C7H13N3O2 — CID 62715106
5-(2-propoxyethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 62715106) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 5-(2-propoxyethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-propoxyethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 62715106 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 5-(2-propoxyethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCCOCCc1nnc(N)o1 |
| InChI | InChI=1S/C7H13N3O2/c1-2-4-11-5-3-6-9-10-7(8)12-6/h2-5H2,1H3,(H2,8,10) |
| InChIKey | ULMFPTLLENEDKW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|