C3H4FN3O — CID 84731061
5-(fluoromethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 84731061) has the molecular formula C3H4FN3O and a molecular weight of 117.08 g/mol. Its IUPAC name is 5-(fluoromethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(fluoromethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 84731061 |
| Molecular Formula | C3H4FN3O |
| Molecular Weight | 117.08 g/mol |
| Exact Mass | 117.03 |
| IUPAC Name | 5-(fluoromethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(CF)o1 |
| InChI | InChI=1S/C3H4FN3O/c4-1-2-6-7-3(5)8-2/h1H2,(H2,5,7) |
| InChIKey | VIHZYZXGYWSUPD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.08 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |