C13H16N4O2 — CID 170758052
5-[[6-(oxan-4-yl)-2-pyridinyl]methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 170758052) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-[[6-(oxan-4-yl)-2-pyridinyl]methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[[6-(oxan-4-yl)-2-pyridinyl]methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 170758052 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-[[6-(oxan-4-yl)-2-pyridinyl]methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(Cc2cccc(C3CCOCC3)n2)o1 |
| InChI | InChI=1S/C13H16N4O2/c14-13-17-16-12(19-13)8-10-2-1-3-11(15-10)9-4-6-18-7-5-9/h1-3,9H,4-8H2,(H2,14,17) |
| InChIKey | DCFBSDGDQLCVBC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |