About 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine
5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 82468042) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine.
Analyze 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine (CID 82468042) is 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine is Nc1nnc(CCNC2CC2)o1.
What is the InChIKey of 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine?
The InChIKey is IIUFSTGTSOBTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c8-7-11-10-6(12-7)3-4-9-5-1-2-5/h5,9H,1-4H2,(H2,8,11).
What are the key properties of 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine?
5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine has a molecular weight of 168.20 g/mol, XLogP of -0.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(cyclopropylamino)ethyl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 82468042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).