C9H11F4N3O — CID 104632969
N-[2-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]ethyl]cyclopropanamine (PubChem CID 104632969) has the molecular formula C9H11F4N3O and a molecular weight of 253.20 g/mol. Its IUPAC name is N-[2-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]ethyl]cyclopropanamine.
| Compound Name | N-[2-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 104632969 |
| Molecular Formula | C9H11F4N3O |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-[2-[5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazol-2-yl]ethyl]cyclopropanamine |
| SMILES | FC(F)C(F)(F)c1nnc(CCNC2CC2)o1 |
| InChI | InChI=1S/C9H11F4N3O/c10-7(11)9(12,13)8-16-15-6(17-8)3-4-14-5-1-2-5/h5,7,14H,1-4H2 |
| InChIKey | HKGLIBFCOJVEHD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|