C6H5ClF4N2O — CID 104632668
2-(2-chloroethyl)-5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole (PubChem CID 104632668) has the molecular formula C6H5ClF4N2O and a molecular weight of 232.56 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 104632668 |
| Molecular Formula | C6H5ClF4N2O |
| Molecular Weight | 232.56 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 2-(2-chloroethyl)-5-(1,1,2,2-tetrafluoroethyl)-1,3,4-oxadiazole |
| SMILES | FC(F)C(F)(F)c1nnc(CCCl)o1 |
| InChI | InChI=1S/C6H5ClF4N2O/c7-2-1-3-12-13-5(14-3)6(10,11)4(8)9/h4H,1-2H2 |
| InChIKey | GIARAFBMXQIYRC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|