C11H8ClF3N2O — CID 43513245
2-(2-chloroethyl)-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 43513245) has the molecular formula C11H8ClF3N2O and a molecular weight of 276.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43513245 |
| Molecular Formula | C11H8ClF3N2O |
| Molecular Weight | 276.65 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-(2-chloroethyl)-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1cccc(-c2nnc(CCCl)o2)c1 |
| InChI | InChI=1S/C11H8ClF3N2O/c12-5-4-9-16-17-10(18-9)7-2-1-3-8(6-7)11(13,14)15/h1-3,6H,4-5H2 |
| InChIKey | QJVCHFRHKKOUCQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|