C19H12F3N3O3 — CID 16588065
(4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate (PubChem CID 16588065) has the molecular formula C19H12F3N3O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate.
| Compound Name | (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate |
|---|---|
| PubChem CID | 16588065 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate |
| SMILES | N#Cc1ccc(OC(=O)CCc2nnc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C19H12F3N3O3/c20-19(21,22)14-3-1-2-13(10-14)18-25-24-16(28-18)8-9-17(26)27-15-6-4-12(11-23)5-7-15/h1-7,10H,8-9H2 |
| InChIKey | RUGWZCQDJLAPST-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|