About (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate
(4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate (PubChem CID 16588065) has the molecular formula C19H12F3N3O3
and a molecular weight of 387.32 g/mol. Its IUPAC name is (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate |
| PubChem CID | 16588065 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate |
| SMILES | N#Cc1ccc(OC(=O)CCc2nnc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C19H12F3N3O3/c20-19(21,22)14-3-1-2-13(10-14)18-25-24-16(28-18)8-9-17(26)27-15-6-4-12(11-23)5-7-15/h1-7,10H,8-9H2 |
| InChIKey | RUGWZCQDJLAPST-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate?
The IUPAC name of (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate (CID 16588065) is (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate.
What is the SMILES notation for (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate?
The canonical SMILES for (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate is N#Cc1ccc(OC(=O)CCc2nnc(-c3cccc(C(F)(F)F)c3)o2)cc1.
What is the InChIKey of (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate?
The InChIKey is RUGWZCQDJLAPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3N3O3/c20-19(21,22)14-3-1-2-13(10-14)18-25-24-16(28-18)8-9-17(26)27-15-6-4-12(11-23)5-7-15/h1-7,10H,8-9H2.
What are the key properties of (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate?
(4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate has a molecular weight of 387.32 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 3-[5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]propanoate is sourced from PubChem (CID 16588065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).