C18H13N3O3 — CID 9201836
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-cyanobenzoate (PubChem CID 9201836) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-cyanobenzoate.
| Compound Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-cyanobenzoate |
|---|---|
| PubChem CID | 9201836 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-cyanobenzoate |
| SMILES | Cc1cccc(-c2nnc(COC(=O)c3ccc(C#N)cc3)o2)c1 |
| InChI | InChI=1S/C18H13N3O3/c1-12-3-2-4-15(9-12)17-21-20-16(24-17)11-23-18(22)14-7-5-13(10-19)6-8-14/h2-9H,11H2,1H3 |
| InChIKey | IAKDJFOTLKDOEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |