C17H11Cl2FN2O3 — CID 8627067
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4-dichloro-5-fluorobenzoate (PubChem CID 8627067) has the molecular formula C17H11Cl2FN2O3 and a molecular weight of 381.19 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8627067 |
| Molecular Formula | C17H11Cl2FN2O3 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 2,4-dichloro-5-fluorobenzoate |
| SMILES | Cc1cccc(-c2nnc(COC(=O)c3cc(F)c(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C17H11Cl2FN2O3/c1-9-3-2-4-10(5-9)16-22-21-15(25-16)8-24-17(23)11-6-14(20)13(19)7-12(11)18/h2-7H,8H2,1H3 |
| InChIKey | GCJJQZNAXTXWAQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|