C21H17N5O5 — CID 86887026
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxylate (PubChem CID 86887026) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxylate.
| Compound Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 86887026 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 1-methyl-3-(4-nitrophenyl)pyrazole-4-carboxylate |
| SMILES | Cc1cccc(-c2nnc(COC(=O)c3cn(C)nc3-c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C21H17N5O5/c1-13-4-3-5-15(10-13)20-23-22-18(31-20)12-30-21(27)17-11-25(2)24-19(17)14-6-8-16(9-7-14)26(28)29/h3-11H,12H2,1-2H3 |
| InChIKey | VOYNLJAZYKRZOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 126.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|