C24H18N4O6 — CID 30101463
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(3-methylbenzoyl)amino]benzoate (PubChem CID 30101463) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(3-methylbenzoyl)amino]benzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(3-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 30101463 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(3-methylbenzoyl)amino]benzoate |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C24H18N4O6/c1-15-5-4-6-17(13-15)22(29)25-20-8-3-2-7-19(20)24(30)33-14-21-26-27-23(34-21)16-9-11-18(12-10-16)28(31)32/h2-13H,14H2,1H3,(H,25,29) |
| InChIKey | ZLKWGAVAIGOQMX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|