C19H18N4O7S — CID 55552511
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(propylsulfonylamino)benzoate (PubChem CID 55552511) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(propylsulfonylamino)benzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(propylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 55552511 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(propylsulfonylamino)benzoate |
| SMILES | CCCS(=O)(=O)Nc1cccc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C19H18N4O7S/c1-2-10-31(27,28)22-15-5-3-4-14(11-15)19(24)29-12-17-20-21-18(30-17)13-6-8-16(9-7-13)23(25)26/h3-9,11,22H,2,10,12H2,1H3 |
| InChIKey | XOLVAFXSXIVLOJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|