C18H16N4O7S — CID 55475604
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(ethylsulfamoyl)benzoate (PubChem CID 55475604) has the molecular formula C18H16N4O7S and a molecular weight of 432.41 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55475604 |
| Molecular Formula | C18H16N4O7S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C18H16N4O7S/c1-2-19-30(26,27)15-5-3-4-13(10-15)18(23)28-11-16-20-21-17(29-16)12-6-8-14(9-7-12)22(24)25/h3-10,19H,2,11H2,1H3 |
| InChIKey | AZRBAFVQJYCASB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|