C21H22N4O8S — CID 55309780
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 55309780) has the molecular formula C21H22N4O8S and a molecular weight of 490.49 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55309780 |
| Molecular Formula | C21H22N4O8S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)ccc1OC |
| InChI | InChI=1S/C21H22N4O8S/c1-4-24(5-2)34(29,30)18-12-15(8-11-17(18)31-3)21(26)32-13-19-22-23-20(33-19)14-6-9-16(10-7-14)25(27)28/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | JNOKKZUWWRCVFD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 154.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|