C19H17N3O4 — CID 9015747
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-acetamidobenzoate (PubChem CID 9015747) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-acetamidobenzoate.
| Compound Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-acetamidobenzoate |
|---|---|
| PubChem CID | 9015747 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCc2nnc(-c3cccc(C)c3)o2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-12-4-3-5-15(10-12)18-22-21-17(26-18)11-25-19(24)14-6-8-16(9-7-14)20-13(2)23/h3-10H,11H2,1-2H3,(H,20,23) |
| InChIKey | RAORZAHWRJUVGY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |