C5H2ClF5N2O — CID 104632661
2-(chloromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole (PubChem CID 104632661) has the molecular formula C5H2ClF5N2O and a molecular weight of 236.53 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 104632661 |
| Molecular Formula | C5H2ClF5N2O |
| Molecular Weight | 236.53 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 2-(chloromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-oxadiazole |
| SMILES | FC(F)(F)C(F)(F)c1nnc(CCl)o1 |
| InChI | InChI=1S/C5H2ClF5N2O/c6-1-2-12-13-3(14-2)4(7,8)5(9,10)11/h1H2 |
| InChIKey | BCQMHHZGPKLUII-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|