C6H11ClN2O — CID 145188643
2-(chloromethyl)-5-methyl-1,3,4-oxadiazole;ethane (PubChem CID 145188643) has the molecular formula C6H11ClN2O and a molecular weight of 162.62 g/mol. Its IUPAC name is 2-(chloromethyl)-5-methyl-1,3,4-oxadiazole;ethane.
| Compound Name | 2-(chloromethyl)-5-methyl-1,3,4-oxadiazole;ethane |
|---|---|
| PubChem CID | 145188643 |
| Molecular Formula | C6H11ClN2O |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 2-(chloromethyl)-5-methyl-1,3,4-oxadiazole;ethane |
| SMILES | CC.Cc1nnc(CCl)o1 |
| InChI | InChI=1S/C4H5ClN2O.C2H6/c1-3-6-7-4(2-5)8-3;1-2/h2H2,1H3;1-2H3 |
| InChIKey | UPYCZKWCYRCTIV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|