About 2,5-dimethyl-1,3,4-oxadiazole;propane
2,5-dimethyl-1,3,4-oxadiazole;propane (PubChem CID 143140950) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,5-dimethyl-1,3,4-oxadiazole;propane.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,3,4-oxadiazole;propane |
| PubChem CID | 143140950 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2,5-dimethyl-1,3,4-oxadiazole;propane |
| SMILES | CCC.Cc1nnc(C)o1 |
| InChI | InChI=1S/C4H6N2O.C3H8/c1-3-5-6-4(2)7-3;1-3-2/h1-2H3;3H2,1-2H3 |
| InChIKey | DVDOZCYFJCFIOC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-1,3,4-oxadiazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,3,4-oxadiazole;propane?
The IUPAC name of 2,5-dimethyl-1,3,4-oxadiazole;propane (CID 143140950) is 2,5-dimethyl-1,3,4-oxadiazole;propane.
What is the SMILES notation for 2,5-dimethyl-1,3,4-oxadiazole;propane?
The canonical SMILES for 2,5-dimethyl-1,3,4-oxadiazole;propane is CCC.Cc1nnc(C)o1.
What is the InChIKey of 2,5-dimethyl-1,3,4-oxadiazole;propane?
The InChIKey is DVDOZCYFJCFIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O.C3H8/c1-3-5-6-4(2)7-3;1-3-2/h1-2H3;3H2,1-2H3.
What are the key properties of 2,5-dimethyl-1,3,4-oxadiazole;propane?
2,5-dimethyl-1,3,4-oxadiazole;propane has a molecular weight of 142.20 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,3,4-oxadiazole;propane is sourced from PubChem (CID 143140950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).