C6H5ClN4O3 — CID 139229250
4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 139229250) has the molecular formula C6H5ClN4O3 and a molecular weight of 216.58 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium.
| Compound Name | 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 139229250 |
| Molecular Formula | C6H5ClN4O3 |
| Molecular Weight | 216.58 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | Cc1c(-c2nnc(CCl)o2)no[n+]1[O-] |
| InChI | InChI=1S/C6H5ClN4O3/c1-3-5(10-14-11(3)12)6-9-8-4(2-7)13-6/h2H2,1H3 |
| InChIKey | SAUCOFLWRWJGPK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.58 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|