C7H5ClN2O2 — CID 3689757
2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole (PubChem CID 3689757) has the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3689757 |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole |
| SMILES | ClCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C7H5ClN2O2/c8-4-6-9-10-7(12-6)5-2-1-3-11-5/h1-3H,4H2 |
| InChIKey | ITPFFLTUPKAJHE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|