C8H8N2O2S — CID 82158215
2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]ethanethiol (PubChem CID 82158215) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]ethanethiol.
| Compound Name | 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]ethanethiol |
|---|---|
| PubChem CID | 82158215 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]ethanethiol |
| SMILES | SCCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C8H8N2O2S/c13-5-3-7-9-10-8(12-7)6-2-1-4-11-6/h1-2,4,13H,3,5H2 |
| InChIKey | VGIIIXQBFUVRBC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|