About 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol
2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol (PubChem CID 82160241) has the molecular formula C10H9BrN2OS
and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol.
Molecular Properties
| Compound Name | 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol |
| PubChem CID | 82160241 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol |
| SMILES | SCCc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C10H9BrN2OS/c11-8-4-2-1-3-7(8)10-13-12-9(14-10)5-6-15/h1-4,15H,5-6H2 |
| InChIKey | DRMHODYFWVFRPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol?
The IUPAC name of 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol (CID 82160241) is 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol.
What is the SMILES notation for 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol?
The canonical SMILES for 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol is SCCc1nnc(-c2ccccc2Br)o1.
What is the InChIKey of 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol?
The InChIKey is DRMHODYFWVFRPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2OS/c11-8-4-2-1-3-7(8)10-13-12-9(14-10)5-6-15/h1-4,15H,5-6H2.
What are the key properties of 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol?
2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol has a molecular weight of 285.17 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]ethanethiol is sourced from PubChem (CID 82160241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).